Carboxylic acid imides
Accela Chembio Inc N-(4-bromobutyl)phthalimide | 100g | 5394-18-3 | MFCD00005905 | 97+% | Shelf Life: 1080 Days | Light Sensitive
N-(4-bromobutyl)phthalimide | 100g | 5394-18-3 | MFCD00005905 | 97+% | Shelf Life: 1080 Days | Light Sensitive
Sigma Aldrich Fine Chemicals Biosciences Piperlongumine >=97% (HPLC) | 20069-09-4 | MFCD00075706 | 5MG
Piperlongumine >=97% (HPLC) | Purity: >=97% (HPLC) | Mol Wt: 317.34 | 20069-09-4 | MFCD00075706 | 5MG
eMolecules 6097-07-0 | N-(4-Pentynyl)phthalimide | Combi-Blocks, Inc. | MFCD06798110 | 213.236 | C13H11NO2 | 98.000 | O=C1N(CCCC#C)C(=O)c2ccccc12 | 25g | 603146318
N-(4-Pentynyl)phthalimide | Combi-Blocks, Inc. | 6097-07-0 | MFCD06798110 | 213.236 | C13H11NO2 | 98.000 | O=C1N(CCCC#C)C(=O)c2ccccc12 | 25g | 603146318
Chem-Impex International, Inc. N-Carboethoxy phthalimide | 22509-74-6 | MFCD00005893 | 100G
N-Carboethoxy phthalimide, 22509-74-6, MFCD00005893, 100G
![eMolecules 60846-91-5 | (S)-3-N-Cbz-amino-succinimide | Combi-Blocks, Inc. | MFCD05864630 | 248.238 | C12H12N2O4 | 97.000 | O=C(N[C@H]1CC(=O)NC1=O)OCc1ccccc1 | 1g | 603143184](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502189066.JPG-250.jpg)
eMolecules 60846-91-5 | (S)-3-N-Cbz-amino-succinimide | Combi-Blocks, Inc. | MFCD05864630 | 248.238 | C12H12N2O4 | 97.000 | O=C(N[C@H]1CC(=O)NC1=O)OCc1ccccc1 | 1g | 603143184
(S)-3-N-Cbz-amino-succinimide | Combi-Blocks, Inc. | 60846-91-5 | MFCD05864630 | 248.238 | C12H12N2O4 | 97.000 | O=C(N[C@H]1CC(=O)NC1=O)OCc1ccccc1 | 1g | 603143184
eMolecules 2055840-00-9 | 1-(3-CARBOXYPHENYL METHYL) PIPERAZINE-2HCL | MFCD25372075 | 0.25g
Ambeed | 1-(4-Bromobenzenesulfonyl)piperidine-3-carboxylic acid | 1g | 572843225 | A1007043 | 377772-91-3 | MFCD02655932 | 348.210 | C12H14BrNO4S
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>
eMolecules 883-38-5 | 5-chloro-1-methyl-3-phenylpyrazole-4-carbaldehyde | ChemScene | MFCD00244899 | 220.660 | C11H9ClN2O | 98.000 | Cn1nc(c(C=O)c1Cl)-c1ccccc1 | 250mg | 572282302
5-chloro-1-methyl-3-phenylpyrazole-4-carbaldehyde | ChemScene | 883-38-5 | MFCD00244899 | 220.660 | C11H9ClN2O | 98.000 | Cn1nc(c(C=O)c1Cl)-c1ccccc1 | 250mg | 572282302
![eMolecules 179747-84-3 | (R)-3-N-CBZ-AMINO-SUCCINIMIDE | AstaTech | MFCD06796620 | 248.238 | C12H12N2O4 | 97.000 | O=C(N[C@@H]1CC(=O)NC1=O)OCc1ccccc1 | 5g | 112529884](https://assets.fishersci.com/TFS-Assets/CCG/product-images/502171256.JPG-250.jpg)
eMolecules 179747-84-3 | (R)-3-N-CBZ-AMINO-SUCCINIMIDE | AstaTech | MFCD06796620 | 248.238 | C12H12N2O4 | 97.000 | O=C(N[C@@H]1CC(=O)NC1=O)OCc1ccccc1 | 5g | 112529884
(R)-3-N-CBZ-AMINO-SUCCINIMIDE | AstaTech | 179747-84-3 | MFCD06796620 | 248.238 | C12H12N2O4 | 97.000 | O=C(N[C@@H]1CC(=O)NC1=O)OCc1ccccc1 | 5g | 112529884
eMolecules 4-(Trifluoromethyl)phthalic acid | 835-58-5 | MFCD00671572 | 1g
Matrix Scientific | 4-(Trifluoromethyl)phthalic acid | 1g | 448037289 | 5435 | 95.000 | 835-58-5 | MFCD00671572 | 234.130 | C9H5F3O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
Sigma Aldrich Fine Chemicals Biosciences Locostatin 50MG
Locostatin | ≥98% | 245.27 | 90719-30-5 | MFCD00278769 | 50MG
eMolecules 216959-34-1 | Ethyl N-(tert-butoxycarbonyl)oxamate | Combi-Blocks | MFCD01631201 | 217.221 | C9H15NO5 | 96.000 | CCOC(=O)C(=O)NC(=O)OC(C)(C)C | 1g | 267211399
Ethyl N-(tert-butoxycarbonyl)oxamate | Combi-Blocks | 216959-34-1 | MFCD01631201 | 217.221 | C9H15NO5 | 96.000 | CCOC(=O)C(=O)NC(=O)OC(C)(C)C | 1g | 267211399
Chem-Impex International, Inc. 1,3-Dibromo-5,5-dimethylhydantoin | MFCD00003189 | 250G
1,3-Dibromo-5,5-dimethylhydantoin, MFCD00003189, 250G
eMolecules 1256346-21-0 | 4-Chloro-2-fluoro-3-isopropoxyphenylboronic acid | Combi-Blocks | MFCD17015738 | 232.440 | C9H11BClFO3 | 98.000 | CC(C)Oc1c(Cl)ccc(B(O)O)c1F | 1g | 117524632
4-Chloro-2-fluoro-3-isopropoxyphenylboronic acid | Combi-Blocks | 1256346-21-0 | MFCD17015738 | 232.440 | C9H11BClFO3 | 98.000 | CC(C)Oc1c(Cl)ccc(B(O)O)c1F | 1g | 117524632
eMolecules 2096335-18-9 | 3-Chloro-5-fluoro-4-isopropoxyphenylboronic acid | Combi-Blocks | MFCD20441800 | 232.440 | C9H11BClFO3 | 98.000 | CC(C)Oc1c(F)cc(cc1Cl)B(O)O | 1g | 117523435
3-Chloro-5-fluoro-4-isopropoxyphenylboronic acid | Combi-Blocks | 2096335-18-9 | MFCD20441800 | 232.440 | C9H11BClFO3 | 98.000 | CC(C)Oc1c(F)cc(cc1Cl)B(O)O | 1g | 117523435
eMolecules 1333493-13-2 | ChemScene | (R)-4-((7-Ethyl-8-isopropyl-5-methyl-6-oxo-5678-tetrahydropteridin-2-yl)amino)-3-methoxybenzoic acid | 100mg | 642097960 | CS-0028467 | MFCD22565663 | 399.451 | C20H25N5O4
Medchem Express | THZ1 | 5mg | 446271624 | HY-80013 | 1604810-83-4 | MFCD28167785 | 566.060 | C31H28ClN7O2
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool<|a>